C10H17N3OS — CID 106370535
1-[(5-ethyl-1,3-oxazol-2-yl)methyl]-3-propylthiourea (PubChem CID 106370535) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is 1-[(5-ethyl-1,3-oxazol-2-yl)methyl]-3-propylthiourea.
| Compound Name | 1-[(5-ethyl-1,3-oxazol-2-yl)methyl]-3-propylthiourea |
|---|---|
| PubChem CID | 106370535 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 1-[(5-ethyl-1,3-oxazol-2-yl)methyl]-3-propylthiourea |
| SMILES | CCCNC(=S)NCc1ncc(CC)o1 |
| InChI | InChI=1S/C10H17N3OS/c1-3-5-11-10(15)13-7-9-12-6-8(4-2)14-9/h6H,3-5,7H2,1-2H3,(H2,11,13,15) |
| InChIKey | ALSLWGKHYRSLBT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|