C14H15N3O4 — CID 106373959
2-[(5-ethyl-1,3-oxazol-2-yl)methylcarbamoylamino]benzoic acid (PubChem CID 106373959) has the molecular formula C14H15N3O4 and a molecular weight of 289.29 g/mol. Its IUPAC name is 2-[(5-ethyl-1,3-oxazol-2-yl)methylcarbamoylamino]benzoic acid.
| Compound Name | 2-[(5-ethyl-1,3-oxazol-2-yl)methylcarbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 106373959 |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 2-[(5-ethyl-1,3-oxazol-2-yl)methylcarbamoylamino]benzoic acid |
| SMILES | CCc1cnc(CNC(=O)Nc2ccccc2C(=O)O)o1 |
| InChI | InChI=1S/C14H15N3O4/c1-2-9-7-15-12(21-9)8-16-14(20)17-11-6-4-3-5-10(11)13(18)19/h3-7H,2,8H2,1H3,(H,18,19)(H2,16,17,20) |
| InChIKey | XMZKEVMVFQBUCK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |