C10H13BrN2O2 — CID 106376506
3-bromo-1-[(5-methyl-1,3-oxazol-2-yl)methyl]piperidin-2-one (PubChem CID 106376506) has the molecular formula C10H13BrN2O2 and a molecular weight of 273.13 g/mol. Its IUPAC name is 3-bromo-1-[(5-methyl-1,3-oxazol-2-yl)methyl]piperidin-2-one.
| Compound Name | 3-bromo-1-[(5-methyl-1,3-oxazol-2-yl)methyl]piperidin-2-one |
|---|---|
| PubChem CID | 106376506 |
| Molecular Formula | C10H13BrN2O2 |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 3-bromo-1-[(5-methyl-1,3-oxazol-2-yl)methyl]piperidin-2-one |
| SMILES | Cc1cnc(CN2CCCC(Br)C2=O)o1 |
| InChI | InChI=1S/C10H13BrN2O2/c1-7-5-12-9(15-7)6-13-4-2-3-8(11)10(13)14/h5,8H,2-4,6H2,1H3 |
| InChIKey | YYEPZVWEBZAGBN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|