C12H14ClN5OS — CID 106382579
4-[[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106382579) has the molecular formula C12H14ClN5OS and a molecular weight of 311.80 g/mol. Its IUPAC name is 4-[[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106382579 |
| Molecular Formula | C12H14ClN5OS |
| Molecular Weight | 311.80 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 4-[[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]methyl]-3H-1,3-thiazol-2-one |
| SMILES | Cc1nn(C)c2c1nc(C(C)Cl)n2Cc1csc(=O)[nH]1 |
| InChI | InChI=1S/C12H14ClN5OS/c1-6(13)10-15-9-7(2)16-17(3)11(9)18(10)4-8-5-20-12(19)14-8/h5-6H,4H2,1-3H3,(H,14,19) |
| InChIKey | FMRYUEHOBAAOAB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 68.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.80 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|