C10H14N4O3S — CID 106382993
2-oxo-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]-2-piperazin-1-ylacetamide (PubChem CID 106382993) has the molecular formula C10H14N4O3S and a molecular weight of 270.31 g/mol. Its IUPAC name is 2-oxo-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]-2-piperazin-1-ylacetamide.
| Compound Name | 2-oxo-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]-2-piperazin-1-ylacetamide |
|---|---|
| PubChem CID | 106382993 |
| Molecular Formula | C10H14N4O3S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-oxo-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]-2-piperazin-1-ylacetamide |
| SMILES | O=C(NCc1csc(=O)[nH]1)C(=O)N1CCNCC1 |
| InChI | InChI=1S/C10H14N4O3S/c15-8(9(16)14-3-1-11-2-4-14)12-5-7-6-18-10(17)13-7/h6,11H,1-5H2,(H,12,15)(H,13,17) |
| InChIKey | JSWGODJLHZGAMD-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|