C9H12N6O3 — CID 106386761
N-(4-azidobutyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide (PubChem CID 106386761) has the molecular formula C9H12N6O3 and a molecular weight of 252.23 g/mol. Its IUPAC name is N-(4-azidobutyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide.
| Compound Name | N-(4-azidobutyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 106386761 |
| Molecular Formula | C9H12N6O3 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | N-(4-azidobutyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide |
| SMILES | [N-]=[N+]=NCCCCNC(=O)c1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C9H12N6O3/c10-15-12-4-2-1-3-11-8(17)6-5-7(16)14-9(18)13-6/h5H,1-4H2,(H,11,17)(H2,13,14,16,18) |
| InChIKey | QVYIDHJWUSZUTH-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 143.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|