C11H16BrF5 — CID 10639618
11-bromo-1,1,2,3,3-pentafluoroundec-1-ene (PubChem CID 10639618) has the molecular formula C11H16BrF5 and a molecular weight of 323.14 g/mol. Its IUPAC name is 11-bromo-1,1,2,3,3-pentafluoroundec-1-ene.
| Compound Name | 11-bromo-1,1,2,3,3-pentafluoroundec-1-ene |
|---|---|
| PubChem CID | 10639618 |
| Molecular Formula | C11H16BrF5 |
| Molecular Weight | 323.14 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 11-bromo-1,1,2,3,3-pentafluoroundec-1-ene |
| SMILES | FC(F)=C(F)C(F)(F)CCCCCCCCBr |
| InChI | InChI=1S/C11H16BrF5/c12-8-6-4-2-1-3-5-7-11(16,17)9(13)10(14)15/h1-8H2 |
| InChIKey | SNIYFWDOKCAKBQ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.14 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|