C14H16Br2F12O — CID 88672271
6-bromo-2-[6-bromo-1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-yl]oxy-1,1,1-trifluoro-2-(trifluoromethyl)hexane (PubChem CID 88672271) has the molecular formula C14H16Br2F12O and a molecular weight of 588.06 g/mol. Its IUPAC name is 6-bromo-2-[6-bromo-1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-yl]oxy-1,1,1-trifluoro-2-(trifluoromethyl)hexane.
| Compound Name | 6-bromo-2-[6-bromo-1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-yl]oxy-1,1,1-trifluoro-2-(trifluoromethyl)hexane |
|---|---|
| PubChem CID | 88672271 |
| Molecular Formula | C14H16Br2F12O |
| Molecular Weight | 588.06 g/mol |
| Exact Mass | 585.94 |
| IUPAC Name | 6-bromo-2-[6-bromo-1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-yl]oxy-1,1,1-trifluoro-2-(trifluoromethyl)hexane |
| SMILES | FC(F)(F)C(CCCCBr)(OC(CCCCBr)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H16Br2F12O/c15-7-3-1-5-9(11(17,18)19,12(20,21)22)29-10(13(23,24)25,14(26,27)28)6-2-4-8-16/h1-8H2 |
| InChIKey | CJSMVEKHBOSPHS-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.06 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|