C8H13N3O3 — CID 106399525
2-methyl-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]propanoic acid (PubChem CID 106399525) has the molecular formula C8H13N3O3 and a molecular weight of 199.21 g/mol. Its IUPAC name is 2-methyl-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]propanoic acid.
| Compound Name | 2-methyl-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]propanoic acid |
|---|---|
| PubChem CID | 106399525 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 2-methyl-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]propanoic acid |
| SMILES | CC(CNCCc1ncno1)C(=O)O |
| InChI | InChI=1S/C8H13N3O3/c1-6(8(12)13)4-9-3-2-7-10-5-11-14-7/h5-6,9H,2-4H2,1H3,(H,12,13) |
| InChIKey | IABQQMXFWZFERT-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|