C10H17N3O3 — CID 106399627
methyl 2,2-dimethyl-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]propanoate (PubChem CID 106399627) has the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. Its IUPAC name is methyl 2,2-dimethyl-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]propanoate.
| Compound Name | methyl 2,2-dimethyl-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]propanoate |
|---|---|
| PubChem CID | 106399627 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | methyl 2,2-dimethyl-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]propanoate |
| SMILES | COC(=O)C(C)(C)CNCCc1ncno1 |
| InChI | InChI=1S/C10H17N3O3/c1-10(2,9(14)15-3)6-11-5-4-8-12-7-13-16-8/h7,11H,4-6H2,1-3H3 |
| InChIKey | OZMDFJNRWZXTOX-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|