C10H14N6O3S — CID 106412648
4-amino-2-(2-methoxyethylamino)-N-(1,2,4-oxadiazol-3-ylmethyl)-1,3-thiazole-5-carboxamide (PubChem CID 106412648) has the molecular formula C10H14N6O3S and a molecular weight of 298.33 g/mol. Its IUPAC name is 4-amino-2-(2-methoxyethylamino)-N-(1,2,4-oxadiazol-3-ylmethyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-2-(2-methoxyethylamino)-N-(1,2,4-oxadiazol-3-ylmethyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 106412648 |
| Molecular Formula | C10H14N6O3S |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 4-amino-2-(2-methoxyethylamino)-N-(1,2,4-oxadiazol-3-ylmethyl)-1,3-thiazole-5-carboxamide |
| SMILES | COCCNc1nc(N)c(C(=O)NCc2ncon2)s1 |
| InChI | InChI=1S/C10H14N6O3S/c1-18-3-2-12-10-15-8(11)7(20-10)9(17)13-4-6-14-5-19-16-6/h5H,2-4,11H2,1H3,(H,12,15)(H,13,17) |
| InChIKey | MIBBCIADWRWYKP-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 128.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|