C13H20BrN5O — CID 106416472
N-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-2-(3-methyl-1,2,4-oxadiazol-5-yl)ethanamine (PubChem CID 106416472) has the molecular formula C13H20BrN5O and a molecular weight of 342.24 g/mol. Its IUPAC name is N-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-2-(3-methyl-1,2,4-oxadiazol-5-yl)ethanamine.
| Compound Name | N-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-2-(3-methyl-1,2,4-oxadiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 106416472 |
| Molecular Formula | C13H20BrN5O |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | N-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-2-(3-methyl-1,2,4-oxadiazol-5-yl)ethanamine |
| SMILES | CCc1nn(CC)c(CNCCc2nc(C)no2)c1Br |
| InChI | InChI=1S/C13H20BrN5O/c1-4-10-13(14)11(19(5-2)17-10)8-15-7-6-12-16-9(3)18-20-12/h15H,4-8H2,1-3H3 |
| InChIKey | KNRGYEGXQKLYQC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|