C10H15N5OS — CID 106419304
4-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-3-propan-2-yl-1H-1,2,4-triazole-5-thione (PubChem CID 106419304) has the molecular formula C10H15N5OS and a molecular weight of 253.33 g/mol. Its IUPAC name is 4-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-3-propan-2-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-3-propan-2-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 106419304 |
| Molecular Formula | C10H15N5OS |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 4-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-3-propan-2-yl-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1nc(CCn2c(C(C)C)n[nH]c2=S)no1 |
| InChI | InChI=1S/C10H15N5OS/c1-6(2)9-12-13-10(17)15(9)5-4-8-11-7(3)16-14-8/h6H,4-5H2,1-3H3,(H,13,17) |
| InChIKey | RJIGUHRHZGMCCV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|