C7H15ClN4S — CID 54594525
4-(2-aminoethyl)-3-propan-2-yl-1H-1,2,4-triazole-5-thione;hydrochloride (PubChem CID 54594525) has the molecular formula C7H15ClN4S and a molecular weight of 222.75 g/mol. Its IUPAC name is 4-(2-aminoethyl)-3-propan-2-yl-1H-1,2,4-triazole-5-thione;hydrochloride.
| Compound Name | 4-(2-aminoethyl)-3-propan-2-yl-1H-1,2,4-triazole-5-thione;hydrochloride |
|---|---|
| PubChem CID | 54594525 |
| Molecular Formula | C7H15ClN4S |
| Molecular Weight | 222.75 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 4-(2-aminoethyl)-3-propan-2-yl-1H-1,2,4-triazole-5-thione;hydrochloride |
| SMILES | CC(C)c1n[nH]c(=S)n1CCN.Cl |
| InChI | InChI=1S/C7H14N4S.ClH/c1-5(2)6-9-10-7(12)11(6)4-3-8;/h5H,3-4,8H2,1-2H3,(H,10,12);1H |
| InChIKey | VPZPUFIWOOCFBD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 59.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.75 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|