C13H17NO2S — CID 106426559
2-[1-(2-prop-2-ynylsulfanylethylamino)ethyl]benzene-1,4-diol (PubChem CID 106426559) has the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. Its IUPAC name is 2-[1-(2-prop-2-ynylsulfanylethylamino)ethyl]benzene-1,4-diol.
| Compound Name | 2-[1-(2-prop-2-ynylsulfanylethylamino)ethyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 106426559 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 2-[1-(2-prop-2-ynylsulfanylethylamino)ethyl]benzene-1,4-diol |
| SMILES | C#CCSCCNC(C)c1cc(O)ccc1O |
| InChI | InChI=1S/C13H17NO2S/c1-3-7-17-8-6-14-10(2)12-9-11(15)4-5-13(12)16/h1,4-5,9-10,14-16H,6-8H2,2H3 |
| InChIKey | ZNTDCUAJGKGKQQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|