C13H21NO3 — CID 66090624
2-[1-[(4-hydroxy-2-methylbutyl)amino]ethyl]benzene-1,4-diol (PubChem CID 66090624) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 2-[1-[(4-hydroxy-2-methylbutyl)amino]ethyl]benzene-1,4-diol.
| Compound Name | 2-[1-[(4-hydroxy-2-methylbutyl)amino]ethyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 66090624 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 2-[1-[(4-hydroxy-2-methylbutyl)amino]ethyl]benzene-1,4-diol |
| SMILES | CC(CCO)CNC(C)c1cc(O)ccc1O |
| InChI | InChI=1S/C13H21NO3/c1-9(5-6-15)8-14-10(2)12-7-11(16)3-4-13(12)17/h3-4,7,9-10,14-17H,5-6,8H2,1-2H3 |
| InChIKey | JVIXZKREXQDJPQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|