C12H23F3N2S — CID 106429796
3-methyl-N-propyl-1-[2-(trifluoromethylsulfanyl)ethyl]piperidin-4-amine (PubChem CID 106429796) has the molecular formula C12H23F3N2S and a molecular weight of 284.39 g/mol. Its IUPAC name is 3-methyl-N-propyl-1-[2-(trifluoromethylsulfanyl)ethyl]piperidin-4-amine.
| Compound Name | 3-methyl-N-propyl-1-[2-(trifluoromethylsulfanyl)ethyl]piperidin-4-amine |
|---|---|
| PubChem CID | 106429796 |
| Molecular Formula | C12H23F3N2S |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 3-methyl-N-propyl-1-[2-(trifluoromethylsulfanyl)ethyl]piperidin-4-amine |
| SMILES | CCCNC1CCN(CCSC(F)(F)F)CC1C |
| InChI | InChI=1S/C12H23F3N2S/c1-3-5-16-11-4-6-17(9-10(11)2)7-8-18-12(13,14)15/h10-11,16H,3-9H2,1-2H3 |
| InChIKey | CHPUVFYPCVGRMP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |