C18H36O4Si2 — CID 10643056
(1R,4S,5S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-5-triethylsilyloxy-2-oxabicyclo[2.2.1]heptan-3-one (PubChem CID 10643056) has the molecular formula C18H36O4Si2 and a molecular weight of 372.65 g/mol. Its IUPAC name is (1R,4S,5S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-5-triethylsilyloxy-2-oxabicyclo[2.2.1]heptan-3-one.
| Compound Name | (1R,4S,5S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-5-triethylsilyloxy-2-oxabicyclo[2.2.1]heptan-3-one |
|---|---|
| PubChem CID | 10643056 |
| Molecular Formula | C18H36O4Si2 |
| Molecular Weight | 372.65 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | (1R,4S,5S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-5-triethylsilyloxy-2-oxabicyclo[2.2.1]heptan-3-one |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2C[C@@H]1C(=O)O2 |
| InChI | InChI=1S/C18H36O4Si2/c1-9-24(10-2,11-3)22-15-13-12-14(20-17(13)19)16(15)21-23(7,8)18(4,5)6/h13-16H,9-12H2,1-8H3/t13-,14+,15-,16-/m0/s1 |
| InChIKey | KBZBVIRIPRJKAC-FZKCQIBNSA-N |
| XLogP | 4.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.65 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|