C13H20F3N3O2S — CID 106433553
tert-butyl N-[2-[3-[2-(trifluoromethylsulfanyl)ethyl]imidazol-4-yl]ethyl]carbamate (PubChem CID 106433553) has the molecular formula C13H20F3N3O2S and a molecular weight of 339.38 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[2-(trifluoromethylsulfanyl)ethyl]imidazol-4-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[2-(trifluoromethylsulfanyl)ethyl]imidazol-4-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 106433553 |
| Molecular Formula | C13H20F3N3O2S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | tert-butyl N-[2-[3-[2-(trifluoromethylsulfanyl)ethyl]imidazol-4-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1cncn1CCSC(F)(F)F |
| InChI | InChI=1S/C13H20F3N3O2S/c1-12(2,3)21-11(20)18-5-4-10-8-17-9-19(10)6-7-22-13(14,15)16/h8-9H,4-7H2,1-3H3,(H,18,20) |
| InChIKey | CHLJETDNCJABME-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |