About 1-(3-chloro-2-methylprop-2-enyl)-4,5-dimethylimidazole
1-(3-chloro-2-methylprop-2-enyl)-4,5-dimethylimidazole (PubChem CID 106440202) has the molecular formula C9H13ClN2
and a molecular weight of 184.67 g/mol. Its IUPAC name is 1-(3-chloro-2-methylprop-2-enyl)-4,5-dimethylimidazole.
Analyze 1-(3-chloro-2-methylprop-2-enyl)-4,5-dimethylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chloro-2-methylprop-2-enyl)-4,5-dimethylimidazole?
The IUPAC name of 1-(3-chloro-2-methylprop-2-enyl)-4,5-dimethylimidazole (CID 106440202) is 1-(3-chloro-2-methylprop-2-enyl)-4,5-dimethylimidazole.
What is the SMILES notation for 1-(3-chloro-2-methylprop-2-enyl)-4,5-dimethylimidazole?
The canonical SMILES for 1-(3-chloro-2-methylprop-2-enyl)-4,5-dimethylimidazole is CC(=CCl)Cn1cnc(C)c1C.
What is the InChIKey of 1-(3-chloro-2-methylprop-2-enyl)-4,5-dimethylimidazole?
The InChIKey is FTECZHNCQJCSJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13ClN2/c1-7(4-10)5-12-6-11-8(2)9(12)3/h4,6H,5H2,1-3H3.
What are the key properties of 1-(3-chloro-2-methylprop-2-enyl)-4,5-dimethylimidazole?
1-(3-chloro-2-methylprop-2-enyl)-4,5-dimethylimidazole has a molecular weight of 184.67 g/mol, XLogP of 2.64, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chloro-2-methylprop-2-enyl)-4,5-dimethylimidazole is sourced from PubChem (CID 106440202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).