C16H27N7O5 — CID 10644496
(2S)-2-[5-(4-amino-2-oxopyrimidin-1-yl)pentoxycarbonylamino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 10644496) has the molecular formula C16H27N7O5 and a molecular weight of 397.44 g/mol. Its IUPAC name is (2S)-2-[5-(4-amino-2-oxopyrimidin-1-yl)pentoxycarbonylamino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[5-(4-amino-2-oxopyrimidin-1-yl)pentoxycarbonylamino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 10644496 |
| Molecular Formula | C16H27N7O5 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | (2S)-2-[5-(4-amino-2-oxopyrimidin-1-yl)pentoxycarbonylamino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)OCCCCCn1ccc(N)nc1=O)C(=O)O |
| InChI | InChI=1S/C16H27N7O5/c17-12-6-9-23(15(26)22-12)8-2-1-3-10-28-16(27)21-11(13(24)25)5-4-7-20-14(18)19/h6,9,11H,1-5,7-8,10H2,(H,21,27)(H,24,25)(H2,17,22,26)(H4,18,19,20)/t11-/m0/s1 |
| InChIKey | XZRVVZUYFBUDNN-NSHDSACASA-N |
| XLogP | -0.77 |
| TPSA | 200.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|