C16H26N6O6 — CID 10644551
(2S)-2-[5-(4-amino-2-oxopyrimidin-1-yl)pentoxycarbonylamino]-5-(carbamoylamino)pentanoic acid (PubChem CID 10644551) has the molecular formula C16H26N6O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is (2S)-2-[5-(4-amino-2-oxopyrimidin-1-yl)pentoxycarbonylamino]-5-(carbamoylamino)pentanoic acid.
| Compound Name | (2S)-2-[5-(4-amino-2-oxopyrimidin-1-yl)pentoxycarbonylamino]-5-(carbamoylamino)pentanoic acid |
|---|---|
| PubChem CID | 10644551 |
| Molecular Formula | C16H26N6O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | (2S)-2-[5-(4-amino-2-oxopyrimidin-1-yl)pentoxycarbonylamino]-5-(carbamoylamino)pentanoic acid |
| SMILES | NC(=O)NCCC[C@H](NC(=O)OCCCCCn1ccc(N)nc1=O)C(=O)O |
| InChI | InChI=1S/C16H26N6O6/c17-12-6-9-22(15(26)21-12)8-2-1-3-10-28-16(27)20-11(13(23)24)5-4-7-19-14(18)25/h6,9,11H,1-5,7-8,10H2,(H,20,27)(H,23,24)(H2,17,21,26)(H3,18,19,25)/t11-/m0/s1 |
| InChIKey | NQJNQJGKOILEMR-NSHDSACASA-N |
| XLogP | -0.38 |
| TPSA | 191.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|