C15H25N7O6 — CID 10597057
(2S)-2-[2-[2-(4-amino-2-oxopyrimidin-1-yl)ethoxy]ethoxycarbonylamino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 10597057) has the molecular formula C15H25N7O6 and a molecular weight of 399.41 g/mol. Its IUPAC name is (2S)-2-[2-[2-(4-amino-2-oxopyrimidin-1-yl)ethoxy]ethoxycarbonylamino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[2-[2-(4-amino-2-oxopyrimidin-1-yl)ethoxy]ethoxycarbonylamino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 10597057 |
| Molecular Formula | C15H25N7O6 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | (2S)-2-[2-[2-(4-amino-2-oxopyrimidin-1-yl)ethoxy]ethoxycarbonylamino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)OCCOCCn1ccc(N)nc1=O)C(=O)O |
| InChI | InChI=1S/C15H25N7O6/c16-11-3-5-22(14(25)21-11)6-7-27-8-9-28-15(26)20-10(12(23)24)2-1-4-19-13(17)18/h3,5,10H,1-2,4,6-9H2,(H,20,26)(H,23,24)(H2,16,21,25)(H4,17,18,19)/t10-/m0/s1 |
| InChIKey | LLLGSWQXDBKLSS-JTQLQIEISA-N |
| XLogP | -1.92 |
| TPSA | 210.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|