C15H24N6O6 — CID 10786240
(2S)-2-[4-(4-amino-2-oxopyrimidin-1-yl)butoxycarbonylamino]-5-(carbamoylamino)pentanoic acid (PubChem CID 10786240) has the molecular formula C15H24N6O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is (2S)-2-[4-(4-amino-2-oxopyrimidin-1-yl)butoxycarbonylamino]-5-(carbamoylamino)pentanoic acid.
| Compound Name | (2S)-2-[4-(4-amino-2-oxopyrimidin-1-yl)butoxycarbonylamino]-5-(carbamoylamino)pentanoic acid |
|---|---|
| PubChem CID | 10786240 |
| Molecular Formula | C15H24N6O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (2S)-2-[4-(4-amino-2-oxopyrimidin-1-yl)butoxycarbonylamino]-5-(carbamoylamino)pentanoic acid |
| SMILES | NC(=O)NCCC[C@H](NC(=O)OCCCCn1ccc(N)nc1=O)C(=O)O |
| InChI | InChI=1S/C15H24N6O6/c16-11-5-8-21(14(25)20-11)7-1-2-9-27-15(26)19-10(12(22)23)4-3-6-18-13(17)24/h5,8,10H,1-4,6-7,9H2,(H,19,26)(H,22,23)(H2,16,20,25)(H3,17,18,24)/t10-/m0/s1 |
| InChIKey | CHEGPJHFFCJHIB-JTQLQIEISA-N |
| XLogP | -0.77 |
| TPSA | 191.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|