C17H28N6O6 — CID 10669357
(2S)-2-[6-(4-amino-2-oxopyrimidin-1-yl)hexoxycarbonylamino]-5-(carbamoylamino)pentanoic acid (PubChem CID 10669357) has the molecular formula C17H28N6O6 and a molecular weight of 412.45 g/mol. Its IUPAC name is (2S)-2-[6-(4-amino-2-oxopyrimidin-1-yl)hexoxycarbonylamino]-5-(carbamoylamino)pentanoic acid.
| Compound Name | (2S)-2-[6-(4-amino-2-oxopyrimidin-1-yl)hexoxycarbonylamino]-5-(carbamoylamino)pentanoic acid |
|---|---|
| PubChem CID | 10669357 |
| Molecular Formula | C17H28N6O6 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | (2S)-2-[6-(4-amino-2-oxopyrimidin-1-yl)hexoxycarbonylamino]-5-(carbamoylamino)pentanoic acid |
| SMILES | NC(=O)NCCC[C@H](NC(=O)OCCCCCCn1ccc(N)nc1=O)C(=O)O |
| InChI | InChI=1S/C17H28N6O6/c18-13-7-10-23(16(27)22-13)9-3-1-2-4-11-29-17(28)21-12(14(24)25)6-5-8-20-15(19)26/h7,10,12H,1-6,8-9,11H2,(H,21,28)(H,24,25)(H2,18,22,27)(H3,19,20,26)/t12-/m0/s1 |
| InChIKey | XKSOUZOEXCUBEF-LBPRGKRZSA-N |
| XLogP | 0.01 |
| TPSA | 191.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|