C15H25N7O5 — CID 10667658
(2S)-2-[4-(4-amino-2-oxopyrimidin-1-yl)butoxycarbonylamino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 10667658) has the molecular formula C15H25N7O5 and a molecular weight of 383.41 g/mol. Its IUPAC name is (2S)-2-[4-(4-amino-2-oxopyrimidin-1-yl)butoxycarbonylamino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[4-(4-amino-2-oxopyrimidin-1-yl)butoxycarbonylamino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 10667658 |
| Molecular Formula | C15H25N7O5 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | (2S)-2-[4-(4-amino-2-oxopyrimidin-1-yl)butoxycarbonylamino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)OCCCCn1ccc(N)nc1=O)C(=O)O |
| InChI | InChI=1S/C15H25N7O5/c16-11-5-8-22(14(25)21-11)7-1-2-9-27-15(26)20-10(12(23)24)4-3-6-19-13(17)18/h5,8,10H,1-4,6-7,9H2,(H,20,26)(H,23,24)(H2,16,21,25)(H4,17,18,19)/t10-/m0/s1 |
| InChIKey | GHBFOTASJAWXOK-JTQLQIEISA-N |
| XLogP | -1.16 |
| TPSA | 200.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|