C21H31FN2O5 — CID 10645245
ditert-butyl (2S,4S)-2-fluoro-4-[[4-(methylamino)benzoyl]amino]pentanedioate (PubChem CID 10645245) has the molecular formula C21H31FN2O5 and a molecular weight of 410.49 g/mol. Its IUPAC name is ditert-butyl (2S,4S)-2-fluoro-4-[[4-(methylamino)benzoyl]amino]pentanedioate.
| Compound Name | ditert-butyl (2S,4S)-2-fluoro-4-[[4-(methylamino)benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 10645245 |
| Molecular Formula | C21H31FN2O5 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | ditert-butyl (2S,4S)-2-fluoro-4-[[4-(methylamino)benzoyl]amino]pentanedioate |
| SMILES | CNc1ccc(C(=O)N[C@@H](C[C@H](F)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H31FN2O5/c1-20(2,3)28-18(26)15(22)12-16(19(27)29-21(4,5)6)24-17(25)13-8-10-14(23-7)11-9-13/h8-11,15-16,23H,12H2,1-7H3,(H,24,25)/t15-,16-/m0/s1 |
| InChIKey | WTDMWUYLVGPQSR-HOTGVXAUSA-N |
| XLogP | 3.24 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |