C23H38O6 — CID 10645259
[(2S,3R,4S,5R,6R)-2-[2-[(2R,4aS)-4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propan-2-yloxy]-4,5-dihydroxy-6-methyloxan-3-yl] acetate (PubChem CID 10645259) has the molecular formula C23H38O6 and a molecular weight of 410.55 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-2-[2-[(2R,4aS)-4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propan-2-yloxy]-4,5-dihydroxy-6-methyloxan-3-yl] acetate.
| Compound Name | [(2S,3R,4S,5R,6R)-2-[2-[(2R,4aS)-4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propan-2-yloxy]-4,5-dihydroxy-6-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 10645259 |
| Molecular Formula | C23H38O6 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-2-[2-[(2R,4aS)-4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propan-2-yloxy]-4,5-dihydroxy-6-methyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)(C)[C@@H]2CC[C@]3(C)CCCC(C)=C3C2)O[C@H](C)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H38O6/c1-13-8-7-10-23(6)11-9-16(12-17(13)23)22(4,5)29-21-20(28-15(3)24)19(26)18(25)14(2)27-21/h14,16,18-21,25-26H,7-12H2,1-6H3/t14-,16-,18+,19+,20-,21+,23+/m1/s1 |
| InChIKey | PNNJWIKVIYVLHF-WGQQLVQJSA-N |
| XLogP | 3.49 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|