About 3-(2-propoxyethyl)-2,4-dihydrochromen-3-amine
3-(2-propoxyethyl)-2,4-dihydrochromen-3-amine (PubChem CID 106459398) has the molecular formula C14H21NO2
and a molecular weight of 235.33 g/mol. Its IUPAC name is 3-(2-propoxyethyl)-2,4-dihydrochromen-3-amine.
Molecular Properties
| Compound Name | 3-(2-propoxyethyl)-2,4-dihydrochromen-3-amine |
| PubChem CID | 106459398 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 3-(2-propoxyethyl)-2,4-dihydrochromen-3-amine |
| SMILES | CCCOCCC1(N)COc2ccccc2C1 |
| InChI | InChI=1S/C14H21NO2/c1-2-8-16-9-7-14(15)10-12-5-3-4-6-13(12)17-11-14/h3-6H,2,7-11,15H2,1H3 |
| InChIKey | HIZAXSZUKWLRHD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-propoxyethyl)-2,4-dihydrochromen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-propoxyethyl)-2,4-dihydrochromen-3-amine?
The IUPAC name of 3-(2-propoxyethyl)-2,4-dihydrochromen-3-amine (CID 106459398) is 3-(2-propoxyethyl)-2,4-dihydrochromen-3-amine.
What is the SMILES notation for 3-(2-propoxyethyl)-2,4-dihydrochromen-3-amine?
The canonical SMILES for 3-(2-propoxyethyl)-2,4-dihydrochromen-3-amine is CCCOCCC1(N)COc2ccccc2C1.
What is the InChIKey of 3-(2-propoxyethyl)-2,4-dihydrochromen-3-amine?
The InChIKey is HIZAXSZUKWLRHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO2/c1-2-8-16-9-7-14(15)10-12-5-3-4-6-13(12)17-11-14/h3-6H,2,7-11,15H2,1H3.
What are the key properties of 3-(2-propoxyethyl)-2,4-dihydrochromen-3-amine?
3-(2-propoxyethyl)-2,4-dihydrochromen-3-amine has a molecular weight of 235.33 g/mol, XLogP of 2.14, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-propoxyethyl)-2,4-dihydrochromen-3-amine is sourced from PubChem (CID 106459398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).