C14H21NO2 — CID 106459398
3-(2-propoxyethyl)-2,4-dihydrochromen-3-amine (PubChem CID 106459398) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 3-(2-propoxyethyl)-2,4-dihydrochromen-3-amine.
| Compound Name | 3-(2-propoxyethyl)-2,4-dihydrochromen-3-amine |
|---|---|
| PubChem CID | 106459398 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 3-(2-propoxyethyl)-2,4-dihydrochromen-3-amine |
| SMILES | CCCOCCC1(N)COc2ccccc2C1 |
| InChI | InChI=1S/C14H21NO2/c1-2-8-16-9-7-14(15)10-12-5-3-4-6-13(12)17-11-14/h3-6H,2,7-11,15H2,1H3 |
| InChIKey | HIZAXSZUKWLRHD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|