C27H52O3 — CID 10646025
[(E)-19-hydroxy-3,7,11,15,19-pentamethylicos-5-en-8-yl] acetate (PubChem CID 10646025) has the molecular formula C27H52O3 and a molecular weight of 424.71 g/mol. Its IUPAC name is [(E)-19-hydroxy-3,7,11,15,19-pentamethylicos-5-en-8-yl] acetate.
| Compound Name | [(E)-19-hydroxy-3,7,11,15,19-pentamethylicos-5-en-8-yl] acetate |
|---|---|
| PubChem CID | 10646025 |
| Molecular Formula | C27H52O3 |
| Molecular Weight | 424.71 g/mol |
| Exact Mass | 424.39 |
| IUPAC Name | [(E)-19-hydroxy-3,7,11,15,19-pentamethylicos-5-en-8-yl] acetate |
| SMILES | CCC(C)C/C=C/C(C)C(CCC(C)CCCC(C)CCCC(C)(C)O)OC(C)=O |
| InChI | InChI=1S/C27H52O3/c1-9-21(2)13-11-17-24(5)26(30-25(6)28)19-18-23(4)15-10-14-22(3)16-12-20-27(7,8)29/h11,17,21-24,26,29H,9-10,12-16,18-20H2,1-8H3/b17-11+ |
| InChIKey | HVKXGCUZQCNXBX-GZTJUZNOSA-N |
| XLogP | 7.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.71 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|