C25H50O2 — CID 101020780
(E)-3,7,11,15,19-pentamethylicos-5-ene-8,9-diol (PubChem CID 101020780) has the molecular formula C25H50O2 and a molecular weight of 382.67 g/mol. Its IUPAC name is (E)-3,7,11,15,19-pentamethylicos-5-ene-8,9-diol.
| Compound Name | (E)-3,7,11,15,19-pentamethylicos-5-ene-8,9-diol |
|---|---|
| PubChem CID | 101020780 |
| Molecular Formula | C25H50O2 |
| Molecular Weight | 382.67 g/mol |
| Exact Mass | 382.38 |
| IUPAC Name | (E)-3,7,11,15,19-pentamethylicos-5-ene-8,9-diol |
| SMILES | CCC(C)C/C=C/C(C)C(O)C(O)CC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C25H50O2/c1-8-20(4)13-11-17-23(7)25(27)24(26)18-22(6)16-10-15-21(5)14-9-12-19(2)3/h11,17,19-27H,8-10,12-16,18H2,1-7H3/b17-11+ |
| InChIKey | FKPSEXOSAHTUKX-GZTJUZNOSA-N |
| XLogP | 7.00 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.67 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|