C19H30O2S — CID 22814172
(E,6R)-6,10-dimethyl-1-phenylsulfanylundec-3-ene-2,10-diol (PubChem CID 22814172) has the molecular formula C19H30O2S and a molecular weight of 322.51 g/mol. Its IUPAC name is (E,6R)-6,10-dimethyl-1-phenylsulfanylundec-3-ene-2,10-diol.
| Compound Name | (E,6R)-6,10-dimethyl-1-phenylsulfanylundec-3-ene-2,10-diol |
|---|---|
| PubChem CID | 22814172 |
| Molecular Formula | C19H30O2S |
| Molecular Weight | 322.51 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | (E,6R)-6,10-dimethyl-1-phenylsulfanylundec-3-ene-2,10-diol |
| SMILES | C[C@@H](C/C=C/C(O)CSc1ccccc1)CCCC(C)(C)O |
| InChI | InChI=1S/C19H30O2S/c1-16(10-8-14-19(2,3)21)9-7-11-17(20)15-22-18-12-5-4-6-13-18/h4-7,11-13,16-17,20-21H,8-10,14-15H2,1-3H3/b11-7+/t16-,17?/m0/s1 |
| InChIKey | HPOSUNDVJQHMJJ-KHJFIDMZSA-N |
| XLogP | 4.66 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|