C20H29ClO2 — CID 22814159
(E,7R)-1-(2-chlorophenyl)-11-hydroxy-7,11-dimethyldodec-4-en-3-one (PubChem CID 22814159) has the molecular formula C20H29ClO2 and a molecular weight of 336.90 g/mol. Its IUPAC name is (E,7R)-1-(2-chlorophenyl)-11-hydroxy-7,11-dimethyldodec-4-en-3-one.
| Compound Name | (E,7R)-1-(2-chlorophenyl)-11-hydroxy-7,11-dimethyldodec-4-en-3-one |
|---|---|
| PubChem CID | 22814159 |
| Molecular Formula | C20H29ClO2 |
| Molecular Weight | 336.90 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | (E,7R)-1-(2-chlorophenyl)-11-hydroxy-7,11-dimethyldodec-4-en-3-one |
| SMILES | C[C@@H](C/C=C/C(=O)CCc1ccccc1Cl)CCCC(C)(C)O |
| InChI | InChI=1S/C20H29ClO2/c1-16(9-7-15-20(2,3)23)8-6-11-18(22)14-13-17-10-4-5-12-19(17)21/h4-6,10-12,16,23H,7-9,13-15H2,1-3H3/b11-6+/t16-/m0/s1 |
| InChIKey | ZENLRTAHOOJKCG-RFKZRZAASA-N |
| XLogP | 5.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.90 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|