C23H30ClNO2S — CID 10319938
3-[2-(4-chlorophenyl)sulfanylphenyl]-N-(6-hydroxy-6-methylheptan-2-yl)propanamide (PubChem CID 10319938) has the molecular formula C23H30ClNO2S and a molecular weight of 420.02 g/mol. Its IUPAC name is 3-[2-(4-chlorophenyl)sulfanylphenyl]-N-(6-hydroxy-6-methylheptan-2-yl)propanamide.
| Compound Name | 3-[2-(4-chlorophenyl)sulfanylphenyl]-N-(6-hydroxy-6-methylheptan-2-yl)propanamide |
|---|---|
| PubChem CID | 10319938 |
| Molecular Formula | C23H30ClNO2S |
| Molecular Weight | 420.02 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 3-[2-(4-chlorophenyl)sulfanylphenyl]-N-(6-hydroxy-6-methylheptan-2-yl)propanamide |
| SMILES | CC(CCCC(C)(C)O)NC(=O)CCc1ccccc1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H30ClNO2S/c1-17(7-6-16-23(2,3)27)25-22(26)15-10-18-8-4-5-9-21(18)28-20-13-11-19(24)12-14-20/h4-5,8-9,11-14,17,27H,6-7,10,15-16H2,1-3H3,(H,25,26) |
| InChIKey | SKGKECOPSIPZHQ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.02 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |