C19H22ClNO2S — CID 11726259
3-[2-(4-chlorophenyl)sulfanylphenyl]-N-(4-hydroxybutyl)propanamide (PubChem CID 11726259) has the molecular formula C19H22ClNO2S and a molecular weight of 363.91 g/mol. Its IUPAC name is 3-[2-(4-chlorophenyl)sulfanylphenyl]-N-(4-hydroxybutyl)propanamide.
| Compound Name | 3-[2-(4-chlorophenyl)sulfanylphenyl]-N-(4-hydroxybutyl)propanamide |
|---|---|
| PubChem CID | 11726259 |
| Molecular Formula | C19H22ClNO2S |
| Molecular Weight | 363.91 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 3-[2-(4-chlorophenyl)sulfanylphenyl]-N-(4-hydroxybutyl)propanamide |
| SMILES | O=C(CCc1ccccc1Sc1ccc(Cl)cc1)NCCCCO |
| InChI | InChI=1S/C19H22ClNO2S/c20-16-8-10-17(11-9-16)24-18-6-2-1-5-15(18)7-12-19(23)21-13-3-4-14-22/h1-2,5-6,8-11,22H,3-4,7,12-14H2,(H,21,23) |
| InChIKey | YFKKSYCWLJIJBN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.91 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|