C21H25ClN2OS — CID 147253871
3-[2-(4-chlorophenyl)sulfanylphenyl]-N-[4-(dimethylamino)butylidene]propanamide (PubChem CID 147253871) has the molecular formula C21H25ClN2OS and a molecular weight of 388.96 g/mol. Its IUPAC name is 3-[2-(4-chlorophenyl)sulfanylphenyl]-N-[4-(dimethylamino)butylidene]propanamide.
| Compound Name | 3-[2-(4-chlorophenyl)sulfanylphenyl]-N-[4-(dimethylamino)butylidene]propanamide |
|---|---|
| PubChem CID | 147253871 |
| Molecular Formula | C21H25ClN2OS |
| Molecular Weight | 388.96 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 3-[2-(4-chlorophenyl)sulfanylphenyl]-N-[4-(dimethylamino)butylidene]propanamide |
| SMILES | CN(C)CCC/C=N/C(=O)CCc1ccccc1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H25ClN2OS/c1-24(2)16-6-5-15-23-21(25)14-9-17-7-3-4-8-20(17)26-19-12-10-18(22)11-13-19/h3-4,7-8,10-13,15H,5-6,9,14,16H2,1-2H3/b23-15+ |
| InChIKey | CNFCZJCRNVBGLU-HZHRSRAPSA-N |
| XLogP | 5.36 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.96 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|