C22H20Cl2O2S — CID 58192601
4-chloro-2-[2-[2-(4-chlorophenyl)sulfanylphenyl]ethyl]-6-(1-hydroxyethyl)phenol (PubChem CID 58192601) has the molecular formula C22H20Cl2O2S and a molecular weight of 419.37 g/mol. Its IUPAC name is 4-chloro-2-[2-[2-(4-chlorophenyl)sulfanylphenyl]ethyl]-6-(1-hydroxyethyl)phenol.
| Compound Name | 4-chloro-2-[2-[2-(4-chlorophenyl)sulfanylphenyl]ethyl]-6-(1-hydroxyethyl)phenol |
|---|---|
| PubChem CID | 58192601 |
| Molecular Formula | C22H20Cl2O2S |
| Molecular Weight | 419.37 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | 4-chloro-2-[2-[2-(4-chlorophenyl)sulfanylphenyl]ethyl]-6-(1-hydroxyethyl)phenol |
| SMILES | CC(O)c1cc(Cl)cc(CCc2ccccc2Sc2ccc(Cl)cc2)c1O |
| InChI | InChI=1S/C22H20Cl2O2S/c1-14(25)20-13-18(24)12-16(22(20)26)7-6-15-4-2-3-5-21(15)27-19-10-8-17(23)9-11-19/h2-5,8-14,25-26H,6-7H2,1H3 |
| InChIKey | CMYZJMAZOSRICF-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.37 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |