C11H20BrN5O — CID 106462722
1-(5-bromo-3-methyltriazol-4-yl)-1-(4-ethylmorpholin-2-yl)-N-methylmethanamine (PubChem CID 106462722) has the molecular formula C11H20BrN5O and a molecular weight of 318.22 g/mol. Its IUPAC name is 1-(5-bromo-3-methyltriazol-4-yl)-1-(4-ethylmorpholin-2-yl)-N-methylmethanamine.
| Compound Name | 1-(5-bromo-3-methyltriazol-4-yl)-1-(4-ethylmorpholin-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 106462722 |
| Molecular Formula | C11H20BrN5O |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 1-(5-bromo-3-methyltriazol-4-yl)-1-(4-ethylmorpholin-2-yl)-N-methylmethanamine |
| SMILES | CCN1CCOC(C(NC)c2c(Br)nnn2C)C1 |
| InChI | InChI=1S/C11H20BrN5O/c1-4-17-5-6-18-8(7-17)9(13-2)10-11(12)14-15-16(10)3/h8-9,13H,4-7H2,1-3H3 |
| InChIKey | XYOAJXPRWJWOJT-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |