C8H12BrN5O3S — CID 106466931
5-bromo-3-methyl-N-(6-oxopiperidin-3-yl)triazole-4-sulfonamide (PubChem CID 106466931) has the molecular formula C8H12BrN5O3S and a molecular weight of 338.19 g/mol. Its IUPAC name is 5-bromo-3-methyl-N-(6-oxopiperidin-3-yl)triazole-4-sulfonamide.
| Compound Name | 5-bromo-3-methyl-N-(6-oxopiperidin-3-yl)triazole-4-sulfonamide |
|---|---|
| PubChem CID | 106466931 |
| Molecular Formula | C8H12BrN5O3S |
| Molecular Weight | 338.19 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | 5-bromo-3-methyl-N-(6-oxopiperidin-3-yl)triazole-4-sulfonamide |
| SMILES | Cn1nnc(Br)c1S(=O)(=O)NC1CCC(=O)NC1 |
| InChI | InChI=1S/C8H12BrN5O3S/c1-14-8(7(9)11-13-14)18(16,17)12-5-2-3-6(15)10-4-5/h5,12H,2-4H2,1H3,(H,10,15) |
| InChIKey | GJIDJARCTJQNCY-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.19 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |