C9H14Br2N4O2S — CID 106367508
5-bromo-N-[2-(bromomethyl)cyclopentyl]-3-methyltriazole-4-sulfonamide (PubChem CID 106367508) has the molecular formula C9H14Br2N4O2S and a molecular weight of 402.11 g/mol. Its IUPAC name is 5-bromo-N-[2-(bromomethyl)cyclopentyl]-3-methyltriazole-4-sulfonamide.
| Compound Name | 5-bromo-N-[2-(bromomethyl)cyclopentyl]-3-methyltriazole-4-sulfonamide |
|---|---|
| PubChem CID | 106367508 |
| Molecular Formula | C9H14Br2N4O2S |
| Molecular Weight | 402.11 g/mol |
| Exact Mass | 399.92 |
| IUPAC Name | 5-bromo-N-[2-(bromomethyl)cyclopentyl]-3-methyltriazole-4-sulfonamide |
| SMILES | Cn1nnc(Br)c1S(=O)(=O)NC1CCCC1CBr |
| InChI | InChI=1S/C9H14Br2N4O2S/c1-15-9(8(11)12-14-15)18(16,17)13-7-4-2-3-6(7)5-10/h6-7,13H,2-5H2,1H3 |
| InChIKey | SRYCVWXSAKCFEZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.11 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|