C10H16BrClN4O2S — CID 106468468
5-bromo-N-(2-chlorocycloheptyl)-3-methyltriazole-4-sulfonamide (PubChem CID 106468468) has the molecular formula C10H16BrClN4O2S and a molecular weight of 371.69 g/mol. Its IUPAC name is 5-bromo-N-(2-chlorocycloheptyl)-3-methyltriazole-4-sulfonamide.
| Compound Name | 5-bromo-N-(2-chlorocycloheptyl)-3-methyltriazole-4-sulfonamide |
|---|---|
| PubChem CID | 106468468 |
| Molecular Formula | C10H16BrClN4O2S |
| Molecular Weight | 371.69 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | 5-bromo-N-(2-chlorocycloheptyl)-3-methyltriazole-4-sulfonamide |
| SMILES | Cn1nnc(Br)c1S(=O)(=O)NC1CCCCCC1Cl |
| InChI | InChI=1S/C10H16BrClN4O2S/c1-16-10(9(11)13-15-16)19(17,18)14-8-6-4-2-3-5-7(8)12/h7-8,14H,2-6H2,1H3 |
| InChIKey | ZKWNXFQZYSFPNW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.69 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|