C10H14N2S — CID 106477221
2-ethyl-5,6,7,8-tetrahydro-1H-quinazoline-4-thione (PubChem CID 106477221) has the molecular formula C10H14N2S and a molecular weight of 194.30 g/mol. Its IUPAC name is 2-ethyl-5,6,7,8-tetrahydro-1H-quinazoline-4-thione.
| Compound Name | 2-ethyl-5,6,7,8-tetrahydro-1H-quinazoline-4-thione |
|---|---|
| PubChem CID | 106477221 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 2-ethyl-5,6,7,8-tetrahydro-1H-quinazoline-4-thione |
| SMILES | CCc1nc(=S)c2c([nH]1)CCCC2 |
| InChI | InChI=1S/C10H14N2S/c1-2-9-11-8-6-4-3-5-7(8)10(13)12-9/h2-6H2,1H3,(H,11,12,13) |
| InChIKey | SADRXCLDQIJKEV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|