C12H14N2S2 — CID 106477898
6-methyl-5-propan-2-yl-2-thiophen-2-yl-1H-pyrimidine-4-thione (PubChem CID 106477898) has the molecular formula C12H14N2S2 and a molecular weight of 250.39 g/mol. Its IUPAC name is 6-methyl-5-propan-2-yl-2-thiophen-2-yl-1H-pyrimidine-4-thione.
| Compound Name | 6-methyl-5-propan-2-yl-2-thiophen-2-yl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106477898 |
| Molecular Formula | C12H14N2S2 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 6-methyl-5-propan-2-yl-2-thiophen-2-yl-1H-pyrimidine-4-thione |
| SMILES | Cc1[nH]c(-c2cccs2)nc(=S)c1C(C)C |
| InChI | InChI=1S/C12H14N2S2/c1-7(2)10-8(3)13-11(14-12(10)15)9-5-4-6-16-9/h4-7H,1-3H3,(H,13,14,15) |
| InChIKey | DLXQOKVVLSEFDQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|