C6H4N2OS2 — CID 62957740
3-thiophen-2-yl-2H-1,2,4-oxadiazole-5-thione (PubChem CID 62957740) has the molecular formula C6H4N2OS2 and a molecular weight of 184.25 g/mol. Its IUPAC name is 3-thiophen-2-yl-2H-1,2,4-oxadiazole-5-thione.
| Compound Name | 3-thiophen-2-yl-2H-1,2,4-oxadiazole-5-thione |
|---|---|
| PubChem CID | 62957740 |
| Molecular Formula | C6H4N2OS2 |
| Molecular Weight | 184.25 g/mol |
| Exact Mass | 183.98 |
| IUPAC Name | 3-thiophen-2-yl-2H-1,2,4-oxadiazole-5-thione |
| SMILES | S=c1nc(-c2cccs2)[nH]o1 |
| InChI | InChI=1S/C6H4N2OS2/c10-6-7-5(8-9-6)4-2-1-3-11-4/h1-3H,(H,7,8,10) |
| InChIKey | BTJRHAMOEYRTRE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|