C18H16BrF3O4S — CID 10647858
(E)-2-(benzenesulfonyl)-1-(4-bromophenyl)-3-ethoxy-4,4,4-trifluorobut-2-en-1-ol (PubChem CID 10647858) has the molecular formula C18H16BrF3O4S and a molecular weight of 465.29 g/mol. Its IUPAC name is (E)-2-(benzenesulfonyl)-1-(4-bromophenyl)-3-ethoxy-4,4,4-trifluorobut-2-en-1-ol.
| Compound Name | (E)-2-(benzenesulfonyl)-1-(4-bromophenyl)-3-ethoxy-4,4,4-trifluorobut-2-en-1-ol |
|---|---|
| PubChem CID | 10647858 |
| Molecular Formula | C18H16BrF3O4S |
| Molecular Weight | 465.29 g/mol |
| Exact Mass | 463.99 |
| IUPAC Name | (E)-2-(benzenesulfonyl)-1-(4-bromophenyl)-3-ethoxy-4,4,4-trifluorobut-2-en-1-ol |
| SMILES | CCO/C(=C(\C(O)c1ccc(Br)cc1)S(=O)(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H16BrF3O4S/c1-2-26-17(18(20,21)22)16(15(23)12-8-10-13(19)11-9-12)27(24,25)14-6-4-3-5-7-14/h3-11,15,23H,2H2,1H3/b17-16+ |
| InChIKey | FQVRZIBVISXGLI-WUKNDPDISA-N |
| XLogP | 4.77 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.29 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|