C15H11BrF4O3S — CID 122232693
3-(benzenesulfonyl)-1-(4-bromophenyl)-2,2,3,3-tetrafluoropropan-1-ol (PubChem CID 122232693) has the molecular formula C15H11BrF4O3S and a molecular weight of 427.21 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-1-(4-bromophenyl)-2,2,3,3-tetrafluoropropan-1-ol.
| Compound Name | 3-(benzenesulfonyl)-1-(4-bromophenyl)-2,2,3,3-tetrafluoropropan-1-ol |
|---|---|
| PubChem CID | 122232693 |
| Molecular Formula | C15H11BrF4O3S |
| Molecular Weight | 427.21 g/mol |
| Exact Mass | 425.95 |
| IUPAC Name | 3-(benzenesulfonyl)-1-(4-bromophenyl)-2,2,3,3-tetrafluoropropan-1-ol |
| SMILES | O=S(=O)(c1ccccc1)C(F)(F)C(F)(F)C(O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H11BrF4O3S/c16-11-8-6-10(7-9-11)13(21)14(17,18)15(19,20)24(22,23)12-4-2-1-3-5-12/h1-9,13,21H |
| InChIKey | FDNONXZKXFMUAN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.21 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|