About (1S)-1-(4-bromophenyl)-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]ethanol
(1S)-1-(4-bromophenyl)-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]ethanol (PubChem CID 135031379) has the molecular formula C14H12BrF5OS
and a molecular weight of 403.21 g/mol. Its IUPAC name is (1S)-1-(4-bromophenyl)-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]ethanol.
Molecular Properties
| Compound Name | (1S)-1-(4-bromophenyl)-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]ethanol |
| PubChem CID | 135031379 |
| Molecular Formula | C14H12BrF5OS |
| Molecular Weight | 403.21 g/mol |
| Exact Mass | 401.97 |
| IUPAC Name | (1S)-1-(4-bromophenyl)-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]ethanol |
| SMILES | O[C@@H](Cc1ccc(S(F)(F)(F)(F)F)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H12BrF5OS/c15-12-5-3-11(4-6-12)14(21)9-10-1-7-13(8-2-10)22(16,17,18,19)20/h1-8,14,21H,9H2/t14-/m0/s1 |
| InChIKey | SCBVJDGYZQTXAX-AWEZNQCLSA-N |
| XLogP | 6.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.21 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1S)-1-(4-bromophenyl)-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-(4-bromophenyl)-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]ethanol?
The IUPAC name of (1S)-1-(4-bromophenyl)-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]ethanol (CID 135031379) is (1S)-1-(4-bromophenyl)-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]ethanol.
What is the SMILES notation for (1S)-1-(4-bromophenyl)-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]ethanol?
The canonical SMILES for (1S)-1-(4-bromophenyl)-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]ethanol is O[C@@H](Cc1ccc(S(F)(F)(F)(F)F)cc1)c1ccc(Br)cc1.
What is the InChIKey of (1S)-1-(4-bromophenyl)-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]ethanol?
The InChIKey is SCBVJDGYZQTXAX-AWEZNQCLSA-N. The full InChI is InChI=1S/C14H12BrF5OS/c15-12-5-3-11(4-6-12)14(21)9-10-1-7-13(8-2-10)22(16,17,18,19)20/h1-8,14,21H,9H2/t14-/m0/s1.
What are the key properties of (1S)-1-(4-bromophenyl)-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]ethanol?
(1S)-1-(4-bromophenyl)-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]ethanol has a molecular weight of 403.21 g/mol, XLogP of 6.38, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-(4-bromophenyl)-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]ethanol is sourced from PubChem (CID 135031379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).