C14H21BrN2S3 — CID 106479633
5-bromo-6-tert-butyl-2-(5,6-dimethyl-1,4-dithian-2-yl)-1H-pyrimidine-4-thione (PubChem CID 106479633) has the molecular formula C14H21BrN2S3 and a molecular weight of 393.44 g/mol. Its IUPAC name is 5-bromo-6-tert-butyl-2-(5,6-dimethyl-1,4-dithian-2-yl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-tert-butyl-2-(5,6-dimethyl-1,4-dithian-2-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106479633 |
| Molecular Formula | C14H21BrN2S3 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | 5-bromo-6-tert-butyl-2-(5,6-dimethyl-1,4-dithian-2-yl)-1H-pyrimidine-4-thione |
| SMILES | CC1SCC(c2nc(=S)c(Br)c(C(C)(C)C)[nH]2)SC1C |
| InChI | InChI=1S/C14H21BrN2S3/c1-7-8(2)20-9(6-19-7)12-16-11(14(3,4)5)10(15)13(18)17-12/h7-9H,6H2,1-5H3,(H,16,17,18) |
| InChIKey | GDYDWZACCXTVRI-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|