C12H15BrN2S3 — CID 106480266
5-bromo-6-cyclopropyl-2-(3-methyl-1,4-dithian-2-yl)-1H-pyrimidine-4-thione (PubChem CID 106480266) has the molecular formula C12H15BrN2S3 and a molecular weight of 363.37 g/mol. Its IUPAC name is 5-bromo-6-cyclopropyl-2-(3-methyl-1,4-dithian-2-yl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-cyclopropyl-2-(3-methyl-1,4-dithian-2-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106480266 |
| Molecular Formula | C12H15BrN2S3 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 361.96 |
| IUPAC Name | 5-bromo-6-cyclopropyl-2-(3-methyl-1,4-dithian-2-yl)-1H-pyrimidine-4-thione |
| SMILES | CC1SCCSC1c1nc(=S)c(Br)c(C2CC2)[nH]1 |
| InChI | InChI=1S/C12H15BrN2S3/c1-6-10(18-5-4-17-6)11-14-9(7-2-3-7)8(13)12(16)15-11/h6-7,10H,2-5H2,1H3,(H,14,15,16) |
| InChIKey | NKFRURFXZPAJNA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|