C12H17BrN2OS3 — CID 106480647
5-bromo-2-(5,6-dimethyl-1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione (PubChem CID 106480647) has the molecular formula C12H17BrN2OS3 and a molecular weight of 381.39 g/mol. Its IUPAC name is 5-bromo-2-(5,6-dimethyl-1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-2-(5,6-dimethyl-1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106480647 |
| Molecular Formula | C12H17BrN2OS3 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 379.97 |
| IUPAC Name | 5-bromo-2-(5,6-dimethyl-1,4-dithian-2-yl)-6-(methoxymethyl)-1H-pyrimidine-4-thione |
| SMILES | COCc1[nH]c(C2CSC(C)C(C)S2)nc(=S)c1Br |
| InChI | InChI=1S/C12H17BrN2OS3/c1-6-7(2)19-9(5-18-6)11-14-8(4-16-3)10(13)12(17)15-11/h6-7,9H,4-5H2,1-3H3,(H,14,15,17) |
| InChIKey | VNBPSXYSNCVYBE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|